ChemNet > CAS > 31270-80-1 4-chlorofuro[3,2-c]pyridine
31270-80-1 4-chlorofuro[3,2-c]pyridine
| product Name |
4-chlorofuro[3,2-c]pyridine |
| CAS No |
31270-80-1 |
| Molecular Formula |
C7H4ClNO |
| Molecular Weight |
153.5658 |
| InChI |
InChI=1/C7H4ClNO/c8-7-5-2-4-10-6(5)1-3-9-7/h1-4H |
| Molecular Structure |
![31270-80-1 4-chlorofuro[3,2-c]pyridine](https://images-a.chemnet.com/suppliers/chembase/301/121301_1.jpg)
|
| Density |
1.377g/cm3 |
| Melting point |
40℃ |
| Boiling point |
242.806°C at 760 mmHg |
| Refractive index |
1.624 |
| Flash point |
100.646°C |
| Vapour Pressur |
0.052mmHg at 25°C |
| Hazard Symbols |
 Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
| MSDS |
Material Safety Data Sheet
|
|
